Cinda Sheldon

Biochemistry Jeopardy

Hydro-carbons

Carbos

Lipids Pro-teins

Nucl. acids

Misc.

10 10 10 10 10 10

20 20 20 20 20 20

30 30 30 30 30 30

40 40 40 40 40 40

50 50 50 50 50 50

Cinda Sheldon

Hydrocarbons $10

How many bonds can a carbon atom form with other atoms?

4

Cinda Sheldon

Hydrocarbons $20

What are compounds with the same molecular formula, but arranged differently in their structures?

isomers

Cinda Sheldon

Hydrocarbons $30

What is the removing of water to join monomers called?

What is the addition of water to split polymers called?

Dehydration synthesisHydrolysis

Cinda Sheldon

Hydrocarbons $40

Match the functional groups:-COOH A. hydroxyl-NH2 B. carboxyl-C=O C. carbonyl-OH D. aminoB , D, C, A

Cinda Sheldon

Hydrocarbons $50

Identify the triglyceride, disaccharide, amino acid and the nucleotide.

Cinda Sheldon

Carbohydrates $10

What is the monomer of a carbohydrate called?

monosaccharide

Cinda Sheldon

Carbohydrates $20

Most sugars end in which suffix?

Give two examples:-ose-glucose, sucrose, fructose, maltose

Cinda Sheldon

Carbohydrates $30

Describe the test used to determine positive results for glucose and what the results would look like:

Benedicts heated turns blue to orange-red

Cinda Sheldon

Carbohydrates $40

Describe the positive test for starch: what is used and what a positive test looks like.

Starch turns iodine from straw yellow to blue-black

Cinda Sheldon

Carbohydrates $50

MATCH:1. Cellulose A. polysacch. - plants2. Glucose B. fiber from plants3. Glycogen C. polysacch. - animals4. Starch D. monosaccharide5. Sucrose E. disaccharide1-B 2-D 3-C 4-A 5-E

Cinda Sheldon

Lipids $10

Which best describes lipids?A. hydrophilic

B. hydrophobic C. ionic D. polar covalentB “water fearing”

Cinda Sheldon

Lipids $20

What is the monomer of lipids?

Fatty acids and glycerol

Cinda Sheldon

Lipids $30

A triglyceride has how many glycerols and how many fatty acids?

1 glycerol (backbone)3 fatty acids

Cinda Sheldon

Lipids $40

What kind of molecules are these lipids?

steroids

Cinda Sheldon

Lipids $50

CH3(CH2)4CH=CHCH2CH=CH(CH2)7COOH

MATCH

A. Monounsaturated

B. Polyunsaturated

C. Saturated

Cinda Sheldon

Proteins $10

What is the monomer of proteins?

Amino acids

Cinda Sheldon

Proteins $20

How many different amino acids are there?

How are they different?

20 R groups

Cinda Sheldon

Protein $30

What does “denaturation” mean? What is a positive test for proteins in the lab?

Unravel proteinsBiurets turns from blue to purple

Cinda Sheldon

Protein $40

Describe how each level of proteins are different:

Cinda Sheldon

Protein $50

List and describe the seven types of proteins:

Structural, storage, signal hormone, contractile, defensive, enzyme, transport

Cinda Sheldon

Nucleic Acids $10

What is the monomer called of nucleic acids?

nucleotide

Cinda Sheldon

Nucleic Acids $20

What is the name of the element found in nucleic acids that is not found in the other macromolecules?

P or phosphorus

Cinda Sheldon

Nucleic Acids $30

What is the main job of nucleic acids?

Store genetic information

Cinda Sheldon

Nucleic Acids $40

List two examples of nucleic acids:

DNARNA

Cinda Sheldon

Nucleic Acids $50

What are the three parts of nucleic acids?

Sugar PhosphatesNitrogenous bases

Cinda Sheldon

MISC. $10

Phospholipids, waxes, and steroids are all:A. proteins C. nucleic acids

B. fats D. carbohydrates

B. fats

Cinda Sheldon

MISC. $20

Artherosclerosis (hardening of the arteries) is caused by what:

Build-up of LDL’s

Cinda Sheldon

Misc. $30

Which is not the same as the other three?A. protein

B. amino acid chain C. polyunsaturate

D. polypeptide

polyunsaturate

Cinda Sheldon

Misc. $40

What is the name of the bond that holds together:A. proteins

B. nucleic acids

A. Peptide B. hydrogen

Cinda Sheldon

Misc. $50

What is:1. shape of DNA2. name of diff. part of amino acids3. positive test for fats A. Helical B. R group C. Translucence on brown paper

Cinda Sheldon

BONUS:Which is a monosaccharide and which is a disaccharide?

Disaccharide Monosaccharide

Cinda Sheldon

How can you tell fats from carbos?

Carbos H:O 2:1

Fats H:O Greater than

twice as many H as OCH3(CH2)10CO2H

CH3(CH2)4(CH=CHCH2)4(CH2)2CO2H

Cinda Sheldon

Where is this polysaccharide stored?

Glycogen

Cellulose

Starch

Liver and muscles in animals

Cell walls of plants

Plants (nuts, potatoes, etc.)

Cinda Sheldon

What if starch underwent hydrolysis, what monomer would form? What test could you do to be sure that is what it is?

Glucose Benedicts blue to orange-red

Cinda Sheldon

Most common carbohydrate in the world?

A. glucose B. cellulose C. starch D. phospholipid

ANSWER: cellulose

Cinda Sheldon

Match the protein structure:

1. Made of 2 or more polypeptides

B. Coiled or pleated C. Folded on

itself(3-D globular or fibrous)

4. Sequence of Amino Acids

A. PrimaryB. SecondaryC. TertiaryD. Quaternary

ANSWERS: 1-D, 2-B, 3-C, 4-A

Cinda Sheldon

What two elements are hydrocrbons made of?

Carbon and hydrogen Nitrogen and carbon Oxygen and carbon Hydrogen and oxygen

ANSWER: hydrogen and carbon