biochemistry jeopardy
Post on 08-Jan-2016
56 Views
Preview:
DESCRIPTION
TRANSCRIPT
Cinda Sheldon
Biochemistry Jeopardy
Hydro-carbons
Carbos
Lipids Pro-teins
Nucl. acids
Misc.
10 10 10 10 10 10
20 20 20 20 20 20
30 30 30 30 30 30
40 40 40 40 40 40
50 50 50 50 50 50
Cinda Sheldon
Hydrocarbons $10
How many bonds can a carbon atom form with other atoms?
4
Cinda Sheldon
Hydrocarbons $20
What are compounds with the same molecular formula, but arranged differently in their structures?
isomers
Cinda Sheldon
Hydrocarbons $30
What is the removing of water to join monomers called?
What is the addition of water to split polymers called?
Dehydration synthesisHydrolysis
Cinda Sheldon
Hydrocarbons $40
Match the functional groups:-COOH A. hydroxyl-NH2 B. carboxyl-C=O C. carbonyl-OH D. aminoB , D, C, A
Cinda Sheldon
Hydrocarbons $50
Identify the triglyceride, disaccharide, amino acid and the nucleotide.
Cinda Sheldon
Carbohydrates $10
What is the monomer of a carbohydrate called?
monosaccharide
Cinda Sheldon
Carbohydrates $20
Most sugars end in which suffix?
Give two examples:-ose-glucose, sucrose, fructose, maltose
Cinda Sheldon
Carbohydrates $30
Describe the test used to determine positive results for glucose and what the results would look like:
Benedicts heated turns blue to orange-red
Cinda Sheldon
Carbohydrates $40
Describe the positive test for starch: what is used and what a positive test looks like.
Starch turns iodine from straw yellow to blue-black
Cinda Sheldon
Carbohydrates $50
MATCH:1. Cellulose A. polysacch. - plants2. Glucose B. fiber from plants3. Glycogen C. polysacch. - animals4. Starch D. monosaccharide5. Sucrose E. disaccharide1-B 2-D 3-C 4-A 5-E
Cinda Sheldon
Lipids $10
Which best describes lipids?A. hydrophilic
B. hydrophobic C. ionic D. polar covalentB “water fearing”
Cinda Sheldon
Lipids $20
What is the monomer of lipids?
Fatty acids and glycerol
Cinda Sheldon
Lipids $30
A triglyceride has how many glycerols and how many fatty acids?
1 glycerol (backbone)3 fatty acids
Cinda Sheldon
Lipids $40
What kind of molecules are these lipids?
steroids
Cinda Sheldon
Lipids $50
CH3(CH2)4CH=CHCH2CH=CH(CH2)7COOH
MATCH
A. Monounsaturated
B. Polyunsaturated
C. Saturated
Cinda Sheldon
Proteins $10
What is the monomer of proteins?
Amino acids
Cinda Sheldon
Proteins $20
How many different amino acids are there?
How are they different?
20 R groups
Cinda Sheldon
Protein $30
What does “denaturation” mean? What is a positive test for proteins in the lab?
Unravel proteinsBiurets turns from blue to purple
Cinda Sheldon
Protein $40
Describe how each level of proteins are different:
Cinda Sheldon
Protein $50
List and describe the seven types of proteins:
Structural, storage, signal hormone, contractile, defensive, enzyme, transport
Cinda Sheldon
Nucleic Acids $10
What is the monomer called of nucleic acids?
nucleotide
Cinda Sheldon
Nucleic Acids $20
What is the name of the element found in nucleic acids that is not found in the other macromolecules?
P or phosphorus
Cinda Sheldon
Nucleic Acids $30
What is the main job of nucleic acids?
Store genetic information
Cinda Sheldon
Nucleic Acids $40
List two examples of nucleic acids:
DNARNA
Cinda Sheldon
Nucleic Acids $50
What are the three parts of nucleic acids?
Sugar PhosphatesNitrogenous bases
Cinda Sheldon
MISC. $10
Phospholipids, waxes, and steroids are all:A. proteins C. nucleic acids
B. fats D. carbohydrates
B. fats
Cinda Sheldon
MISC. $20
Artherosclerosis (hardening of the arteries) is caused by what:
Build-up of LDL’s
Cinda Sheldon
Misc. $30
Which is not the same as the other three?A. protein
B. amino acid chain C. polyunsaturate
D. polypeptide
polyunsaturate
Cinda Sheldon
Misc. $40
What is the name of the bond that holds together:A. proteins
B. nucleic acids
A. Peptide B. hydrogen
Cinda Sheldon
Misc. $50
What is:1. shape of DNA2. name of diff. part of amino acids3. positive test for fats A. Helical B. R group C. Translucence on brown paper
Cinda Sheldon
BONUS:Which is a monosaccharide and which is a disaccharide?
Disaccharide Monosaccharide
Cinda Sheldon
How can you tell fats from carbos?
Carbos H:O 2:1
Fats H:O Greater than
twice as many H as OCH3(CH2)10CO2H
CH3(CH2)4(CH=CHCH2)4(CH2)2CO2H
Cinda Sheldon
Where is this polysaccharide stored?
Glycogen
Cellulose
Starch
Liver and muscles in animals
Cell walls of plants
Plants (nuts, potatoes, etc.)
Cinda Sheldon
What if starch underwent hydrolysis, what monomer would form? What test could you do to be sure that is what it is?
Glucose Benedicts blue to orange-red
Cinda Sheldon
Most common carbohydrate in the world?
A. glucose B. cellulose C. starch D. phospholipid
ANSWER: cellulose
Cinda Sheldon
Match the protein structure:
1. Made of 2 or more polypeptides
B. Coiled or pleated C. Folded on
itself(3-D globular or fibrous)
4. Sequence of Amino Acids
A. PrimaryB. SecondaryC. TertiaryD. Quaternary
ANSWERS: 1-D, 2-B, 3-C, 4-A
Cinda Sheldon
What two elements are hydrocrbons made of?
Carbon and hydrogen Nitrogen and carbon Oxygen and carbon Hydrogen and oxygen
ANSWER: hydrogen and carbon
top related