chem 30 review - molebus (allchem) - chem 30...alkane with –oic acid 3. the carbon atoms of the...

85
Chem 30 Review

Upload: others

Post on 15-May-2020

16 views

Category:

Documents


0 download

TRANSCRIPT

Page 1: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

Chem 30 Review!

Page 2: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

ORGANIC!

Page 3: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

Organic or Inorganic??

Formula OrganicorInorganic?

CaCO3(s) Inorganic(carbonateion)

C25H52(s) Organic

Ca2C(s) Inorganic(carbideion)

CCl4(l) Organic

CH3COOH(l) Organic

CO2(g) Inorganic(oxide)

KCN(s) Inorganic(cyanide)

C12H22O11(s) Organic

Page 4: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

Four Types of Formulas

1.  MolecularFormulas C5H10(g) Notveryusefulfororganic compoundsbecausesomany isomerscanexist

2.  StructuralFormulas

3.  CondensedStructuralFormulas

4.  LineDiagrams–endoflinesegmentrepresentscarbon–itisassumedtosaKsfyeachcarbon’soctet

Page 5: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

Naming Organic Compounds •  AliphaKcHydrocarbons–containsonlyhydrogenandcarbon

atoms–  Straightlinechainsofcarbonatoms–  Alicyclichydrocarbonshavecarbonatomsformingaclosedring.SKll

consideredaliphaKc

Alkanes Alkenes Alkynes

OnlysingleC‐Cbonds

DoubleC‐CBondpresent

TripleC‐Cbondpresent

GeneralformulaCnH2n+2

Generalformula:CnH2n

Generalformula:CnH2n‐2

Saturated Unsaturated Unsaturated

Page 6: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

Summary of Naming Alkanes

1.  Findtheparentchain.Usetheappropriaterootandsuffix.

2.  Numbertheparentchaincarbonatoms,starKngfromtheendclosesttothebranch(es)sothatthenumbersarethelowestpossible

3.  IdenKfyanybranchesandtheirlocaKonnumberontheparentchain(usthesuffix–ylforbranches)

4.  Ifmorethanoneofthesamebranchexist,useamulEplier(di,tri)toshowthis.Remembertoincludeallnumbers

5.  Ifdifferentbranchesexist,nametheminalphabeKcalorder6.  Separatenumbersfromnumbersusingcommas,and

numbersfromwordsusingdashes(noextraspaces)

Page 7: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

CYCLOALKANES •  Basedonevidence,chemistsbelievethatorganiccarbon

compoundssomeKmestaketheformofcyclichydrocarbons:

•  Cycloalkanes:Alkanesthatformaclosedring–  GeneralFormulaCnH2n

•  Twolesshydrogensarepresentthaninstraightchainalkanesbecausethetwoendsofthemoleculearejoined

•  Aretheseconsideredsaturated??Yes,becausetheyhaveonlysinglebondsandthemaxamountofhydrogen'sbondedtothecarbons

•  Cyclo‐compoundswillhaveahigherboilingpointthantheirstraightchainpartners(becausethereisanaddiKonalbondpresent)

Page 8: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

Naming Alkenes and Alkynes

1.  Findtheparentchain.ItMUSTcontainthemulKplebond.

–  Ifthebondisadouble,thesuffixfortheparentchainwillbe‐ene

–  Ifthebondisatriple,thesuffixfortheparentchainwillbe–yne

2.  CountcarbonatomssothatthemulEplebondwillbeonthelowestpossiblenumber.IndicatethenumberthatthemulKplebondfallsondirectlybeforethesuffix

3.  Namebranchesasbefore

Page 9: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

Naming Alkenes and Alkynes 4.  Itispossibleforamoleculetohavemorethanone

doublebond.Thesearecalledalkadienesandhavethesamegeneralformulaasalkynes(CnH2n‐2)

–  Ifthisisthecase,indicatebothnumberswherethedoublebondisformed,andchangethesuffixto–diene.

a)Drawbuta‐1,3‐diene:

b)WhatistheIUPACnameforthefollowing:

buta‐1,2‐diene

Page 10: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

Structural Isomerism

•  Compoundwiththesamemolecularformulabutdifferentstructures– TheywillhavedifferentchemicalandphysicalproperKes–basedontheirdifferentstructures

Page 11: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

•  What do we know about benzene? – FormulaisC6H6(3Dlink)– UnreacKve–sonotruedoubleortriplebonds– Carbon‐carbonbondsarethesamelengthandstrength

– Eachcarbonisbondedtoahydrogen– Sowhatdoesbenzenelooklike??

ThethreedoublebondsresonateresulKnginanoverallbondlengthsomewhereinbetweenasingleandadoublebond,explainingbenzene’sstability

Wewillusethislinestructuralformulatorepresentbenzenein

compounds

Page 12: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

Practice Naming Aromatics

•  Drawthelinestructuralformulafor1‐ethyl‐3‐methylbenzene

•  Drawthelinestructuralformulafor2‐phenylpentane

Page 13: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

Practice Naming Organic Halides

•  Namethefollowing: CH2Cl2

1,2‐dibromoethene Bonus:Try1,2‐dibromo‐1,2‐dichloroethene

chlorobenzene

dichloromethane

Page 14: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

Carboxylic Acids •  Acarboxylgroupiscomposedofacarbonatomdouble

bondedtoanoxygenatomandbondedtoahydroxylgroup(‐COOH)

– Note:Becausethecarboxylgroupinvolvesthreeofthecarbonatom’sfourbonds,thecarboxylisalwaysattheendofacarbonchainorbranch

methanoic acid ethanoic acid

Examples:

Carboxylic acids are weak organic acids

Page 15: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

Naming Carboxylic Acids

1.  Nametheparentalkane2.  Replacethe–eattheendofthenameofthanparent

alkanewith–oicacid3.  Thecarbonatomsofthecarboxylgroupisalwaysgiven

posiKonnumber1.Nameandnumberthebranchesthatareadachedtothecompound.

Draw3‐methylbutanoicacid

HOOC

Remember COOH or HOOC can also represent the

carboxyl group

Page 16: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

Esters

•  ThereacKonbetweenacarboxylicacidandanalcoholproducesanestermoleculeandamoleculeofwater–  ThisreacKonisknownasacondensaEonoresterificaEonreacKon

–  TheesterfuncKonalgroup–COO–issimilartothatofacarboxylicacid,exceptthattheHatomofthecarboxylgrouphasbeenreplacedbyahydrocarbonbranch.

–  EstersareresponsiblefornaturalandarKficialfragranceandflavouringsinplantsandfruits.

Page 17: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

Naming Esters

•  Namethefollowingesterandtheacidandalcoholfromwhichitcanbeprepared.

ethyl butanoate

ethanol butanoic acid

water

Tip: The branch attached to the oxygen (of the –COO) comes first in the name, the chain attached to the carbon (of the –COO) comes second

A strong acid catalyst, such as H2SO4(aq) is used along with some heating

to increase the rate of the organic reaction

Page 18: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

Physical Properties of Simple Hydrocarbons Alkanes Non‐polarmolecules

OnlyintermolecularforcesareLondonForceBoilingpointandmelKngpointincreasewithnumberofcarbonsAllinsolubleinwater(likedissolveslike)–nonpolarandpolardon’tmix1‐4Cs=gas,5‐16Cs=liquid17andup=solidatSATP

Alkenes Non‐polarmolecules,thereforeinsolubleinwaterBoilingpointsslightlylowerthanalkaneswiththesamenumberofcarbonsduetolesselectrons(unsaturated),resulKnginlowerLondonForces

Alkynes Non‐polarmolecules,thereforeinsolubleinwaterHigherboilingpointsthanalkanesandalkeneswithsimilarC#sAcceptedexplanaKon:Linearstructurearoundtriplebondallowselectronstocomeclosertogetherthaninalkanes/enes,resulKngingreaterLondonForce

Branching Themorebranching,thelesssignificanttheLondonForce(~lowerb.p.)‐moresurfaceareainstraightchainhydrocarbonsallowsmoreseparaKonofcharge,resulKngingreaterLondonForce‐seeTable#3pg.378(i.e.pentane(with5Cs)hasab.p.of36oCwhichismuchhigherthandimethylpropane(5Cs)‐12oC)=becausebranchingdecreasedthestrengthoftheLondonforce

Page 19: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

Physical Properties of Hydrocarbon Derivatives

Alcohols Muchhigherboilingpointsthanhydrocarbons(1‐12CsareliquidsatSATP)duetohydrogenbondingbetweenhydroxylgroupsofadjacentmoleculesSmallalcoholsaretotallymiscibleinwater,butthelargerthehydrocarbonpartofthealcohol(nonpolarpart),themorenonpolarthealcoholis

CarboxylicAcids

Likealcoholstheyhavehydrogenbonding,butismoresignificantduetotheC=O.ThismeansgreaterbpsandsolubilitythanalcoholswithsamenumberofCs.

Carboxylicacidswith1‐4Csarecompletelymiscibleinwater

Esters FruityodourinsomecasesPolarbuttheylackthe–OHbondthereforedonothavehydrogenbonding,solowerbpsthanbothalcoholsandcarboxylicacidsEsterswithfewcarbonsarepolarenoughtobesolubleinwater

Compound BoilingPoint(oC)

butane ‐0.5

butan‐1‐ol 117.2

butanoicacid 165.5

Page 20: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

Combustion Reactions •  Burningofhydrocarbonsinthepresenceofoxygen

–  CompleteCombusEon:abundantsupplyofoxygen;productsarecarbondioxide,watervapourandheat

•  Ex.C3H8(l)+5O2(g)3CO2(g)+4H2O(g)

–  IncompleteCombusEon:limitedsupplyofoxygen;productsarecarbonmonoxide,soot(purecarbon)oranycombinaKonofcarbondioxide,carbonmonoxideandsootinaddiKontowatervapourandheat

•  Ex.2C8H18(l)+17O2(g)16CO(g)+18H2O(g)

•  OR2C8H18(l)+9O2(g)16C(s)+18H2O(g)

**AssumecompletecombusKonunlessspecifiedotherwise

Page 21: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

1.  AddiEonReacEons:reacKonofalkenesandalkyneswithhydrogengas,ahalogencompound,orahydrogenhalidecompound.

–  AddiKonreacKonsusuallyoccurinthepresenceofacatalyst

a)  AddiKonwithH2(g)(alsocalledhydrogenaEon)

Page 22: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

2.  SubsEtuEonReacKons–breakingofaC‐HbondinanalkaneoranaromaKcringandreplacingitwithanotheratomorgroupofatoms

–  Usuallyoccurslowlyatroomtemperature,solightmaybenecessaryasacatalyst

–  OqensubsKtutesahalogenforahydrogen

–  NochangeinsaturaKon

Propane contains hydrogen atoms bonded to end carbons and the middle carbon atom, so two different products (isomers) are formed, in unequal proportions

Page 23: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

3.  EliminaEonReacKons–involveseliminaKngatomsorgroupsofatomsfromadjacentcarbonatoms;decreasesthelevelofsaturaKon

a)  Alkanecrackedintoanalkene(useshightemperatures)

b)  Alcoholisreactedwithacatalysttoproduceanalkeneandwater(dehydra'on–removesawatermoleculefromthealcohol)

c)  Alkylhalidereactswithahydroxideion(OH‐)toproduceanalkene(dehydrohalogena'on–removesahydrogenandhalogenatom)

Page 24: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

•  AddiEonPolymerizaEonalwaysresultsinoneproduct,thepolymer

•  RequiresunsaturatedhydrocarbonmonomersandbondsaturaKonoccurswhenthepolymerismade

•  CommonpolymersproducedbyaddiKonpolymerizaKon:

Page 25: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

Condensation Polymerization

•  Monomerscombinetoformapolymerandabi‐product.EachKmeabondformsbetweenmonomers,smallmolecules,suchaswater,ammonia,orHClare“condensed”out.

•  ThepolymerizaKonofnylon:•  For condensation polymerization

to occur, monomers must be bifunctional, meaning they have at least two functional groups.

•  If they only had one functional group, then only one bond would form.

Page 26: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

Polyester •  WhenacarboxylicacidreactswithanalcoholinanesterificaKon

reacKon,awatermoleculeiseliminatedandasingleestermoleculeisformed.

•  ThisesterificaKonreacKoncanberepeatedsomanyestersarejoinedinalongchain…apolyester–  Thisiscreatedusingadicarboxylicacid(anacidwithacarboxylgroup

ateachend)andadiol(analcoholwithahydroxylgroupateachend)

–  TheesterlinkagesareformedendtoendbetweenalternaKngacidandalcoholmolecules

Page 27: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

•  AfracEonaldisEllaEontowercontainstraysposiKonedatvariouslevels.

•  HeatedcrudeoilentersneartheboWomofthetower.

•  Thebodomiskepthot,andthetemperaturegraduallydecreasestowardthetopofthetower.

•  Ascompoundscooltotheirboilingpoint,theycondenseinthecoolertrays.Thestreamsofliquid(calledfracKons)arewithdrawnfromthetoweratvariousheightsalongthetower.

Electronic Visual

Page 28: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

Chemistry 30 Organic Review

Page 29: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

REDOX!

Page 30: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

ReducEon–OxidaEonReacEons“REDOX”

•  IsachemicalreacKoninwhichelectronsaretransferred•  MusthavebothreducEonandoxidaEonhappeningforthereacKonto

occur–  REDUCTION–aprocessinwhichelectronsaregainedbyanenKty–  OXIDATION–aprocessinwhichelectronsarelostbyanenKty

–  Howcanyourememberthis?

“LEOthelionsaysGER” LEO=LosingElectrons=OxidaKon GER=GainingElectrons=ReducKon

Othermemorydevices:OILRIG(OxidaKonIsLosingelectrons,ReducKonIsGainingelectrons)ELMO(ElectronLossMeansOxidaKon)

Page 31: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

▫  Review:“LEOthelionsaysGER”  Lossofelectrons=enKtybeingoxidized  Gainofelectrons=enKtybeingreduced

  BUT….Chemistsdon’tsay“thereactantbeingoxidized”or“thereactantbeingreduced”

  Rather,theyusethetermsOXIDIZINGAGENT(OA)andREDUCINGAGENT(RA)

  OXIDIZINGAGENT:causesoxida'onbyremoving(gaining)electronsfromanothersubstanceinaredoxreacKon

  REDUCINGAGENT:causesreduc'onbydonaKng(losing)electronstoanothersubstanceinaredoxreacKon

Whatdoesthismean?Let’srevisitourfirstexamplewhenzincandhydrochloricacidreacted. Whichreactantwasreduced?Whichwasoxidized?So….WhichistheOxidizingAgent(OA)?WhichistheReducingAgent(RA)

Redox Terms

Zn(s) Zn 2+ (aq) + 2 e-

2 H+(aq) + 2 e- H2 (g)

Reducing Agent

Oxidizing Agent

LEO = Oxidized

GER = Reduced

Page 32: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

•  Checkpage7ofyourdatabooklet.Doesourrankingordermatchupwiththeirs?

Au3+(aq)+3e‐Au(s) Hg2+(aq)+2e‐Hg(s)

Ag+(aq)+1e‐Ag(s) Cu2+(aq)+2e‐Cu(s) Zn2+(aq)+2e‐Zn(s) Mg2+(aq)+2e‐Mg(s)

▫  YES!Becauseofthespontaneityrule!  AreacEonwillbespontaneousifonaredoxtable:

OA RA

above =Spontaneousbelow=Non‐spontaneous

RA ReacEon OA ReacEon

Building Redox Tables #1

SOA

SRA

Page 33: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

CouldcopperpipebeusedtotransportahydrochloricacidsoluKon?

1.  ListallenKKes

2.  IdenKfyallpossibleOA’sandRA’s

3.  IdenKfytheSOAandSRA

4.  Show½reacKonsandbalance

5.  Predictspontaneity

Predicting Redox Reactions

SincethereacKonisnonspontaneous,itshouldbepossibletouseacopperpipeto

carryhydrochloricacid

Page 34: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

•  Example#2

–  NickelmetalisoxidizedtoNi2+(aq)ionsbyanacidifiedpotassiumdichromatesoluKon.If2.50gofmetalisoxidizesby50.0mLofsoluKon,whatistheconcentraKonoftheK2Cr2O7(aq)soluKon?

–  ListenKKespresent,idenKfySOAandSRA:Ni(s)H+(aq)K+(aq)Cr2O7

2‐(aq)H2O(l)

–  WriteoxidaKonandreducKonhalfreacKons.BalancethenumberofelectronsgainedandlostandaddthereacKons

3[Ni(s)Ni2+(aq)+2e‐]

Cr2O72‐(aq)+14H+

(aq)+6e‐2Cr3+(aq)+7H2O(l)

3Ni(s)+Cr2O72‐(aq)+14H+

(aq)3Ni2+(aq+2Cr3+(aq)+7H2O(l)

2.50g50.0mL ?mol/L

2.50gxmolNi(s)x1molCr2O72‐(aq)x__1__=0.284mol/LCr2O7

2‐(aq)

58.69g3molNi(s)0.0500L

Redox Stoichiometry

SOASRA

Page 35: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

•  CoppermetalcanbeoxidizedinabasicsoluKontoformcopper(I)oxide.Whatisthehalf‐reacKonforthisprocess?Cu(s)Cu2O(s)

1.  BalanceallatomsexceptHandO2Cu(s)Cu2O(s)

2.  Balanceoxygenbyaddingwater2Cu(s)+H2O(l)Cu2O(s)

3.  BalancehydrogenbyaddingH+(aq)2Cu(s)+H2O(l)Cu2O(s)+2H+

(aq)

4.  Balancechargebyaddingelectrons2Cu(s)+H2O(l)Cu2O(s)+2H+(aq)+2e‐

BecausethehalfreacKonisoccurringinabasicsoluKon,

5.  AddOH‐(aq)tobothsidestoequalthenumberofH+

(aq)present 2OH‐

(aq)+2Cu(s)+H2O(l)Cu2O(s)+2H+(aq)+2e‐+2OH‐

(aq)

5.  CombineH+(aq)andOH‐

(aq)onthesamesidetoformH2O(l).CancelequalamountsofH2O(l)frombothsides

2OH‐(aq)+2Cu(s)+H2O(l)Cu2O(s)+2H2O(l)+2e‐

2OH‐(aq)+2Cu(s)Cu2O(s)+H2O(l)+2e‐

Practicing Half-Reactions

Page 36: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

Tip:

•  ThesumoftheoxidaKonnumbersforaneutralcompound=0

•  ThesumoftheoxidaKonnumbersforapolyatomicion=ioncharge**ThismethodonlyworksifthereisonlyoneunknownaKerreferringtotheabovetable

Oxidation States

Page 37: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

•  Example:Whennaturalgasburnsinafurnace,carbondioxideandwaterform.IdenKfyoxidaKonandreducKoninthisreacKon.

–  FirstwritethechemicalequaKon(asitisnotprovided)

–  DeterminealloftheoxidaKonnumbers

–  NowlookfortheoxidaKonnumberofanatom/ionthatincreasesasaresultofthereacKonandlabelthechangeasoxidaEon.Theremustalsobeanatom/ionwhoseoxidaKonnumberdecreases.LabelthischangeasreducEon.

Oxidation Numbers and Redox

Page 38: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

Example:ChlorateionsandiodinereactinanacidicsoluKontoproducechlorideionsandiodateions.BalancetheequaKonforthisreacKons. ClO3

‐(aq)+I2(aq)Cl‐(aq)+IO3

‐(aq)

1.  AssignoxidaKonnumberstoallatoms/ionsandlookforthenumbersthatchange.Highlightthese.

Remembertorecordthechangeinthenumberofelectronsperatomandpermoleculeorpolyatomicion.

1.  Thenextstepistodeterminethesimplestwholenumbersthatwillbalancethenumberofelectronstransferredforeachreactant.Thenumbersbecomethecoefficientsofthereactants.ThecoefficientsfortheproductscanbeobtainedbybalancingtheatomswhoseoxidaKonnumbershavechangedandthenanyotheratoms.

2.  AlthoughClandIatomsarebalanced,oxygenisnot.AddH2O(l)moleculestobalancetheOatoms.

3.  AddH+(aq)tobalancethehydrogen.TheredoxequaKonshouldnowbecompletelybalanced.Checkyourworkbychecking

thetotalnumbersofeachatom/iononeachsideandcheckingthetotalelectriccharge,whichshouldalsobebalanced.

Balancing Redox Equations using Oxidation Numbers #2

Page 39: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

•  Example#2:WillaspontaneousreacKonoccurasaresultofanelectrontransferfromonecopper(I)iontoanothercopper(I)ion?

Cu+(aq)+1e‐Cu(s)

Cu+(aq)Cu2+(aq)+1e‐

2Cu+(aq)Cu2+(aq)+Cu(s)

–  YES!Usingtheredoxtableandspontaneityrule,weseethatcopper(I)asanoxidizingagentisabovecopper(I)asareducingagent.Therefore,anaqueoussoluKonofcopper(I)ionswillspontaneously,butslowly,disproporKonateintocopper(II)ionsandcoppermetal.

Disproportionation

Seepg.578Ex.2formoreanotherexample

Page 40: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

VoltaicCellSummary•  Avoltaiccellconsistsoftwo‐halfcells

separatedbyaporousboundarywithsolidelectrodesconnectedbyanexternalcircuit

•  SOAundergoesreducKonatthecathode(+electrode)–cathodeincreasesinmass

•  SRAundergoesoxidaKonattheanode(‐electrode)–anodedecreasesinmass

•  Electronsalwaystravelintheexternalcircuitfromanodetocathode

•  Internally,caKonsmovetowardthecathode,anionsmovetowardtheanode,keepingthesoluKonneutral

Page 41: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

StandardCellsandCellPotenKals  Astandardcellisavoltaiccellwhereeach½cellcontainsallenKKesnecessaryatSATP

condiKonsandallaqueoussoluKonshaveaconcentraKonof1.0mol/L  StandardizingmakescomparisonsandscienKficstudyeasier

  StandardCellPotenEal,E0cell=theelectricpotenKaldifferenceofthecell(voltage)

E0cell=E0rcathode–E0ranode

•  WhereE0risthestandardreducKonpotenKal,andisameasureofastandard½cell’sabilitytoadractelectrons.

•  ThehighertheE0r,thestrongertheOA

•  AllstandardreducKonpotenKalsarebasedonthestandardhydrogen½cellbeing0.00V.ThismeansthatallstandardreducKonpotenKalsthatareposiKvearestrongerOA’sthanhydrogenionsandallstandardreducKonpotenKalsthatarenegaKveareweaker.

•  IftheE0cellisposiEve,thereacKonoccurringisspontaneous.

•  IftheE0cellisnegaEve,thereacKonoccurringisnon‐spontaneous

Page 42: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

ComparingElectrochemicalCells:VoltaicandElectrolyKc

Itisbesttothinkof“posiKve”and“negaKve”forelectrodesaslabels,notcharges.

Page 43: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

AnalyzingElectrolyKcCells#3•  Example:AnelectrolyKccellissetupwithapowersupplyconnectedtotwonickel

electrodesimmersedinanaqueoussoluKoncontainingcadmiumnitrateandzincnitrate.

•  PredicttheequaKonsfortheiniKalreacKonateachelectrodeandthenetcellreacKon.CalculatetheminimumvoltagethatmustbeappliedtomakethereacKonoccur.

Page 44: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

TheChlorideAnomaly(*****Diploma)•  SomeredoxreacKonspredictedusingtheSOAand

SRAfromaredoxtabledonotalwaysoccurinanelectrolyKccell.

•  TheactualreducKonpotenKalrequiredforaparKcularhalf‐reacKonandthereportedhalf‐reacKonreducKonpotenKalmaybequitedifferent(dependingonthecondiKonsorhalf‐reacKons)

–  Thisdifferenceisknownasthehalf‐cellovervoltage.

•  “Asanempiricalrule,youshouldrecognizethatchlorinegasisproducedinsteadofoxygengasinsitua'onswherechlorideandwateraretheonlyreducingagentspresent.”

Page 45: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

PracKce:Half‐CellCalculaKons#1•  Whatisthemassofcopperdepositedatthecathodeofacopper

electrorefiningcelloperatedat12.0Afor40.0min?

–  Yes,wecansolveforthenumberofmoles,andthenusethemoleraKotoconvertfromachemicalamountofonesubstancetoanother.

–  ThelaststepistoconverttothequanKtyrequestedinthequesKon,inthiscasethemassofthecoppermetal

–  CouldwedothisasoneequaKoninstead?

Page 46: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

PracKce:Half‐CellCalculaKons#2•  SilverisdepositedonobjectsinasilverelectroplaKngcell.If0.175gofsilveris

tobedepositedfromasilvercyanidesoluKoninaKmeof10.0min,predictthecurrentrequired.

•  WritethebalancedequaKonforthehalf‐cellreacKon,listthemeasurementsandconversionfactors.

•  Converttomoles,usethemoleraKo,converttothecurrent(C/s)

Page 47: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

THERMOCHEMISTRY!

Page 48: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

EnergyfromtheSun

•  Storedenergyinthechemicalbondsofhydrocarbonsoriginatedfromthesun

Remember:

•  Photosynthesis:–  LiquidH2OandCO2gasglucoseandO2(g)

•  HydrocarboncombusKon:–  Fuel+O2(g)watervapourandCO2gas

Page 49: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

EXOTHERMIC ENDOTHERMIC

•  Achangeinachemicalenergywhereenergy/heatEXITSthechemicalsystem

•  ResultsinadecreaseinchemicalpotenKalenergy

•  Achangeinchemicalenergywhereenergy/heatENTERSthechemicalsystem

•  ResultsinanincreaseinchemicalpotenKalenergy

DOYOUREMEMBER??

Page 50: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

AnIntroducKontoEnergeKcs  Kinetic Energy (Ek) is related to the motion of an entity

  Molecular motion can by translational (straight-line), rotational and vibrational

  Chemical Potential Energy (Ep) is energy stored in the bonds of a substance and relative intermolecular forces

  Thermal Energy is the total kinetic energy of all of the particles of a system. Increases with temperature.

  Symbol (Q), Units (J), Formula used (Q=mcΔT)

  Temperature is a measure of the average kinetic energy of the particles in a system

  Heat is a transfer of thermal energy. Heat is not possessed by a system. Heat is energy flowing between systems.

Page 51: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

ThermalEnergyCalculaKons

  Example: Determine the change in thermal energy when 115 mL of water is heated from 19.6oC to 98.8oC?

The density of a dilute aqueous solution is the same as that of water; that is, 1.00g/mL or 1.00kg/L

c water = 4.19J/g °C or 4.19 kJ/kg °C or 4.19 kJ/L °C

MASS=DENSITYXVOLUME

SHOWHOWL=kgANDmL=g

Page 52: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

ComparingQ’s

NegaKveQvalue

–  Anexothermicchange

–  Heatislostbythesystem

–  Thetemperatureofthesurroundingsincreasesandthetemperatureofthesystemdecreases

–  Example:HotPack

–  QuesKonTips:“Howmuchenergyisreleased?”

PosiKveQvalue

–  Anendothermicchange

–  Heatisgainedbythesystem

–  Thetemperatureofthesystemincreasesandthetemperatureofthesurroundingsdecreases

–  Example:ColdPack

–  QuesKonTips:“Whatheatisrequired?”

Page 53: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

ENTHALPYCHANGES  When 50 mL of 1.0 mol/L hydrochloric acid is neutralized completely by 75 mL of 1.0

mol/L sodium hydroxide in a polystyrene cup calorimeter, the temperature of the total solution changes from 20.2°C to 25.6°C. Determine the enthalpy change that occurs in the chemical system.

  Based upon the evidence available, the enthalpy change for the neutralization of hydrochloric acid in this context is recorded as -2.83 kJ.

IsthisanEndothermicorExothermicreacKon??

Page 54: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

MOLARENTHALPYANDCALORIMETRY•  Can we measure the molar enthalpy of reaction using calorimetry?

•  Yes, but indirectly. We can measure a change in temperature, we can then calculate the change in thermal energy (Q=mct). Then, using the law of conservation of energy we can infer the molar enthalpy.

•  In doing so, we must assume that the change in enthalpy of the chemicals involved in a reaction is equal to the change in thermal energy of the surroundings.

FromthisequaKon,anyoneofthefivevariablescanbedeterminedasan

unknown.

Page 55: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

COMMUNICATINGENTHALPY•  We will be learning how to communicate enthalpy changes in four ways:

1.  By stating the molar enthalpy of a specific reactant in a reaction

2.  By stating the enthalpy change for a balanced reaction equation

3.  By including an energy value as a term in a balanced reaction equation

4.  By drawing a chemical potential energy diagram

Page 56: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

COMMUNICATINGENTHALPY#33.  By including an energy value as a term in a balanced reaction equation

•  If a reaction is endothermic, it requires additional energy to react, so is listed along with the reactants

•  If a reaction is exothermic, energy is released as the reaction proceeds, and is listed along with the products

•  In order to specify the initial and final conditions for measuring the enthalpy change of the reaction, the temperature and pressure may be specified at the end of the equation

Page 57: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

COMMUNICATINGENTHALPY#4

DuringanexothermicreacKon,theenthalpyofthesystemdecreasesandheatflowsintothesurroundings.Weobserveatemperature

increaseinthesurroundings.

DuringanendothermicreacKon,heatflowsfromthesurroundingsintothechemicalsystem.We

observeatemperaturedecreaseinthesurroundings.

Page 58: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

Hess’Law#4•  Example: What is the standard enthalpy of formation of butane? ΔfHm° = ???

•  First, we need to be able to write this balanced formation equation.

4C(s) + 5H2(g) C4H10(g)

•  The following values were determined by calorimetry:

•  What will we need to do to get our net equation?

ΔfHm° = -125.6 kJ/1 mol = -125.6 kJ/mol C4H10

‐ ReverseequaKon(1)andchangetheΔHsign

‐ MulKplyequaKon(2)anditsΔHby4

‐ MulKplyequaKon(3)anditsΔHby5/2

Page 59: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

MOLARENTHALPYOFFORMATION•  Methane is burned in furnaces and in some power plants. What is the standard molar

enthalpy of combustion of methane? Assume that water vapour is a product.

•  Need a balanced chemical equation: CH4(g) + O2(g) CO2(g) + 2H2O(g)

•  Use the formula and the data booklet to calculate the ΔcH°

We found all of the Δf Hm for the compounds two slides ago

Are we finished with -802.5 kJ?? NO!

Page 60: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

ACTIVATIONENERGYOFAREACTIONActivation Energy – (EA)

•  The minimum collision energy required for effective collision

•  Dependant on the kinetic energy of the particles (depend on T)

•  Analogy: If the ball does not have enough kinetic energy to make it over the hill – the trip will not happen. Same idea, if molecules collide without enough energy to rearrange their bonds, the reaction will not occur. (ineffective collision)

Page 61: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

LET’SSEEIFYOUGETIT

DrawenergypathwaydiagramsforgeneralendothermicandageneralexothermicreacKon.Labelthereactants,products,enthalpychange,acKvaKonenergy,andacKvatedcomplex.

Page 62: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

CATALYSTSANDREACTIONRATE  AcatalystisasubstancethatincreasestherateofachemicalreacKonwithoutbeing

consumeditselfintheoverallprocess.

  AcatalystreducesthequanKtyofenergyrequiredtostartthereacKon,andresultsinacatalyzedreacKonproducingagreateryieldinthesameperiodofKmethananuncatalyzedreacKon.

  ItdoesnotalterthenetenthalpychangeforachemicalreacKon

CatalystslowertheacKvaKonenergy,soalargerporKonof

parKcleshavethenecessaryenergytoreact=greateryield

Page 63: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

EQUILIBRIUM!

Page 64: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

4CondiKonsofDynamicEquilibrium*

1.  CanbeachievedinallreversiblereacKonswhentheratesoftheforwardandreversereacEonbecomeequal

Representedby ratherthanby

2.  AllobservableproperEesappearconstant(colour,pH,etc)3.  Canonlybeachievedinaclosedsystem(noexchangeof

maderandmusthaveaconstanttemperature)

4.  EquilibriumcanbeapproachedfromeitherdirecEon.ThismeansthattheequilibriumconcentraKonswillbethesameregardlessifyoustartedwithallreactants,allproducts,oramixtureofthetwo

Page 65: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

DescribingthePosiEonofEquilibrium

1.  PercentYield‐theyieldofproductmeasuredatequilibriumcomparedwiththemaximumpossibleyieldofproduct.

  %yield=producteq’mx100%

productmax

  TheequilibriumconcentraKonisdeterminedexperimentally,themaximumconcentraKonisdeterminedwithstoichiometry

Page 66: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

2.  UsinganEquilibriumConstant,(Kc)

  Example#1:WritetheequilibriumlawexpressionforthereacKonofnitrogenmonoxidegaswithoxygengastoformnitrogendioxidegas.

DescribingthePosiEonofEquilibrium

Page 67: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

2.  UsinganEquilibriumConstant,(Kc)  Note:TheKcvaluedescribestheextentoftheforward

reacKon.

  Kcreverse=1.=Thereciprocalvalue

Kcforward

  Example#2:ThevalueofKcfortheformaKonofHI(g)fromH2(g)andI2(g)is40,atagiventemperature.WhatisthevalueofKcforthedecomposiKonofHI(g)atthesametemperature.

Kcreverse=1. =1=0.025

Kcforward40

DescribingthePosiEonofEquilibrium

Page 68: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

ICEChartsandEquilibriumCalculaEons

•  Example#1:Considerthefollowingequilibriumat100oC:N2O4(g)↔2NO2(g)

•  2.0molofN2O4(g)wasintroducedintoanempty2.0Lbulb.Aqerequilibriumwasestablished,only1.6molofN2O4(g)remained.WhatisthevalueofKc?

E:1.0–x=0.80solveforxx=0.202x=0.40

SolveforKc=(0.40)2 =0.20

(0.80)

N2O4(g) 2NO2(g)

I:1.0mol/L 0

C:‐x +2x

E:1.0–x=0.80 2x

2.0mol=1.0mol/L(I)2.0L

1.6mol=0.8mol/L(E)2.0L

Page 69: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

ICEChartsandEquilibriumCalculaEons  Example#3:Usingaperfectsquare

  GiventhefollowingreacKon:N2(g)+O2(g)↔2NO(g) Kc=0.00250

  DeterminetheequilibriumconcentraKonsforallspeciespresentgiventhattheiniKalconcentraKonofeachreactantis0.200mol/L.

  0.00250=(2x)2squarerootbothsides0.005=2x=0.01–0.05x=2x (0.200‐x)2 0.200–x

=0.01=2.05x=0.00488

N2(g) O2(g) 2NO(g)

I:0.200 0.200 0

C:‐x ‐x +2x

E:0.200‐x 0.200‐x 2x

E:0.195mol/L 0.195mol/L 0.00976mol/L

Page 70: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

•  IdenKfythenatureofthechangesimposedonthefollowingequilibriumsystematthefourKmesindicatedbycoordinatesA,B,CandD

•  At A, the concentration (or pressure) of every chemical in the system is decreased by increasing the container volume. Then the equilibrium shifts to the left (the side with more moles of gas)

•  At B, the temperature is increased. Then the equilibrium shifts to left.

•  At C, C2H6(g) is added to the system. Then the equilibrium shifts to the left.

•  At D, no shift in equilibrium position is apparent; the change imposed must be addition of a catalyst, or of a substance that is not involved in the equilibrium reaction.

Page 71: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

TheWaterIonizaKonConstant,Kw•  SincethemathemaKcalrelaKonshipissimple,wecan

easilyuseKwtocalculateeitherthehydroniumorhydroxideionconcentraKon,iftheotherconcentraKonisknow.

ThepresenceofsubstancesotherthanwaterdecreasesthecertaintyoftheKwvaluetotwosignificantdigits;

1.0x10‐14

Page 72: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

%IonizaKon•  ThepHof0.10mol/LmethanoicacidsoluKonis2.38.

CalculatethepercentreacKonforionizaKonofmethanoicacid.

Page 73: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

Bronsted‐LowryAcid‐BaseConcept

•  Focusesontheroleofthechemicalspeciesinareac'onratherthanontheacidicorbasicproperKesoftheiraqueoussoluKons.

•  BronstedLowryDefiniKonforanAcid:protondonor

•  BronstedLowryDefiniKonforanBase:protonacceptor

Page 74: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

Bronsted‐LowryAcid‐BaseConcept

•  ProtonsmaybegainedinareacKonwithoneenKty,butlostinareacKonwithanotherenKty.

–  Theempiricalterm,amphoteric,referstoachemicalsubstancewiththeabilitytoreactaseitheranacidorbase.

–  ThetheoriKcalterm,amphiproEc,describesanenKty(ionormolecule)havingtheabilitytoeitheracceptordonateaproton.

Page 75: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

ConjugateAcidsandBases•  RULE:Thestrongerthebase,themoreitadractsa

proton(protonacceptor).Thestrongertheacid,thelessitadractsitsownproton(protondonor)

•  Whatdoesthismeanabouttheirconjugatepair??

•  Thestrongeranacid,theweakerisitsconjugatebase.–  IfyouaregoodatdonaKngaproton,thismeanstheconjugatebaseisnotgoodatcompeKngforit(weakadracKonforprotons)

•  Thestrongerabase,theweakerisitsconjugateacid.–  IfyouaregoodataccepKngaproton,thismeanstheconjugateacidisnotgoodatgivingitup(strongadracKonforprotons).

Page 76: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

PredicKngAcid‐BaseReacKons•  5)PredicttheapproximateposiEonofequilibrium

–  Example:WhatwillbethepredominantreacKonifspilleddraincleaner(sodiumhydroxide)soluKonisneutralizedbyvinegar?•  Na+(aq) OH‐

(aq) CH3COOH(aq) H2O(l)

SA

SB

ThereacKonofH3O+(aq)andOH‐

(aq)isalwaysquanKtaKve(100%)soasinglearrowisused

Page 77: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

TableBuilding•  LabExercise16.D

Page 78: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

KaCalculaKons•  Example#1:ThepHofa1.00mol/LsoluKonofaceKcacidis

carefullymeasuredtobe2.38atSATP.WhatisthevalueofKaforaceKcacid?

Regardlessofsize,Kavaluesareusuallyexpressedinscien'ficnota'on=1.7x10‐5

1.00mol/L–0.0042mol/L=0.9958(roundsto1.00–precisionrule)ChangeinconcentraKonisnegligibleinthiscase–butnotalways

Page 79: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

KaCalculaKons•  Example#4:PredictthehydroniumionconcentraKonandpH

fora0.200mol/LaqueoussoluKonofmethanoicacid.

1.8x10‐4=x2 x=0.006=H3O+(aq)concentraKon

(0.200)

ApproximaKonRule:0.200=>10001.8x10‐4

So(0.200‐x)=0.200

Page 80: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

KbCalculaKons•  Example#1:AstudentmeasuresthepHofa0.250mol/L

soluKonofaqueousammoniaandfindsitto11.32.CalculatetheKbforammonia

WewillusethesamemethodasKacalculaKons,butthereisusuallyoneextrastepbecausepHvaluesneedtobeconvertedto

findhydroxideionconcentraKons

14=pH+pOH

pOH=2.68

10‐2.68=0.0021=OH‐(aq)

Kbforammoniais1.8x10‐5

RememberKbhasonly2sigdigs

Page 81: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

CalculaKngOH‐fromKb•  Example#2:FindthehydroxideionamountconcentraKon,pOH,pHandthepercent

reacKon(ionizaKon)ofa1.20mol/LsoluKonofbakingsoda.•  Bakingsoda=NaHCO3(s)Na+(aq)+HCO3

‐(aq)

•  ForHCO3‐(aq),theconjugateacidisH2CO3(aq)whoseKais=4.5x10‐7

ApproximaKonRule:1.20=>10002.2x10‐8

So(1.20‐x)=01.20

2.2x10‐8=x2.x=1.6x10‐4=OH‐(aq)

2.2x10‐8

Page 82: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

CalculaKngOH‐fromKb•  Example#2:FindthehydroxideionamountconcentraKon,pOH,pHandthepercent

reacKon(ionizaKon)ofa1.20mol/LsoluKonofbakingsoda.

2.2x10‐8=x2.x=1.6x10‐4=OH‐(aq)

2.2x10‐8

Page 83: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

PolyproKcEnKKes•  Chem20Review:

–  PolyproEcacids–canlosemorethanoneproton

–  PolyproEcbases–cangainmorethanoneproton

–  IfmorethanoneprotontransferoccursinaKtraKon,chemistsbelievetheprocessoccursasaseriesofsingle‐protontransferreacKons.

•  Onagraph,thismeanstherewillbemorethanoneequivalencepoint

Firstprotontransfer=100%

Secondprotontransfer=100%

CarbonateionisadiproEcbase

Page 84: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that
Page 85: Chem 30 Review - MOLEBUS (ALLCHEM) - Chem 30...alkane with –oic acid 3. The carbon atoms of the carboxyl group is always given posion number 1. Name and number the branches that

BufferingCapacity•  ThelimitoftheabilityofabuffertomaintainapHlevel.

•  WhenoneoftheenKKesoftheconjugateacid‐basepairreactswithanaddedreagentandiscompletelyconsumed,thebufferingfailsandthepHchangesdramaKcally.

AlloftheCH3COOH(aq)isusedup,OH‐addiKonswillnowcausethepHto

drasKcallyincrease

AlloftheCH3COO‐(aq)isusedup,H3O+

addiKonswillnowcausethepHtodrasKcallydecrease